C14H18BrN — CID 115727894
6-bromo-N-but-3-en-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 115727894) has the molecular formula C14H18BrN and a molecular weight of 280.21 g/mol. Its IUPAC name is 6-bromo-N-but-3-en-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-but-3-en-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 115727894 |
| Molecular Formula | C14H18BrN |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 6-bromo-N-but-3-en-2-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | C=CC(C)NC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C14H18BrN/c1-3-10(2)16-14-7-5-11-8-13(15)6-4-12(11)9-14/h3-4,6,8,10,14,16H,1,5,7,9H2,2H3 |
| InChIKey | WCALNOSZIBPJSF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|