C16H20N2O — CID 106226748
4-(hex-1-yn-3-ylamino)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 106226748) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(hex-1-yn-3-ylamino)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 4-(hex-1-yn-3-ylamino)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 106226748 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(hex-1-yn-3-ylamino)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | C#CC(CCC)NC1CC(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C16H20N2O/c1-4-8-12(5-2)17-14-11-16(19)18(3)15-10-7-6-9-13(14)15/h2,6-7,9-10,12,14,17H,4,8,11H2,1,3H3 |
| InChIKey | CGAJEUCXHRYIDE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|