About N-nonyl-2,3-dihydro-1H-inden-2-amine
N-nonyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 107851988) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is N-nonyl-2,3-dihydro-1H-inden-2-amine.
Molecular Properties
| Compound Name | N-nonyl-2,3-dihydro-1H-inden-2-amine |
| PubChem CID | 107851988 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-nonyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCCCCCCCCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H29N/c1-2-3-4-5-6-7-10-13-19-18-14-16-11-8-9-12-17(16)15-18/h8-9,11-12,18-19H,2-7,10,13-15H2,1H3 |
| InChIKey | NLXJMZMSNHOALF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-nonyl-2,3-dihydro-1H-inden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonyl-2,3-dihydro-1H-inden-2-amine?
The IUPAC name of N-nonyl-2,3-dihydro-1H-inden-2-amine (CID 107851988) is N-nonyl-2,3-dihydro-1H-inden-2-amine.
What is the SMILES notation for N-nonyl-2,3-dihydro-1H-inden-2-amine?
The canonical SMILES for N-nonyl-2,3-dihydro-1H-inden-2-amine is CCCCCCCCCNC1Cc2ccccc2C1.
What is the InChIKey of N-nonyl-2,3-dihydro-1H-inden-2-amine?
The InChIKey is NLXJMZMSNHOALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-2-3-4-5-6-7-10-13-19-18-14-16-11-8-9-12-17(16)15-18/h8-9,11-12,18-19H,2-7,10,13-15H2,1H3.
What are the key properties of N-nonyl-2,3-dihydro-1H-inden-2-amine?
N-nonyl-2,3-dihydro-1H-inden-2-amine has a molecular weight of 259.44 g/mol, XLogP of 4.49, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonyl-2,3-dihydro-1H-inden-2-amine is sourced from PubChem (CID 107851988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).