C13H19NS — CID 63981661
N-(3-methylsulfanylpropyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 63981661) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(3-methylsulfanylpropyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 63981661 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(3-methylsulfanylpropyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | CSCCCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H19NS/c1-15-8-4-7-14-13-9-11-5-2-3-6-12(11)10-13/h2-3,5-6,13-14H,4,7-10H2,1H3 |
| InChIKey | NLTSUTJAQDASSX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|