C15H21NO2 — CID 171725916
methyl 5-(2,3-dihydro-1H-inden-2-ylamino)pentanoate (PubChem CID 171725916) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl 5-(2,3-dihydro-1H-inden-2-ylamino)pentanoate.
| Compound Name | methyl 5-(2,3-dihydro-1H-inden-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 171725916 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl 5-(2,3-dihydro-1H-inden-2-ylamino)pentanoate |
| SMILES | COC(=O)CCCCNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO2/c1-18-15(17)8-4-5-9-16-14-10-12-6-2-3-7-13(12)11-14/h2-3,6-7,14,16H,4-5,8-11H2,1H3 |
| InChIKey | HGBCDBMWNFWKNS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|