C15H21NO4S — CID 62305600
methyl 4-(1,2,3,4-tetrahydronaphthalen-2-ylsulfamoyl)butanoate (PubChem CID 62305600) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is methyl 4-(1,2,3,4-tetrahydronaphthalen-2-ylsulfamoyl)butanoate.
| Compound Name | methyl 4-(1,2,3,4-tetrahydronaphthalen-2-ylsulfamoyl)butanoate |
|---|---|
| PubChem CID | 62305600 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 4-(1,2,3,4-tetrahydronaphthalen-2-ylsulfamoyl)butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC1CCc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO4S/c1-20-15(17)7-4-10-21(18,19)16-14-9-8-12-5-2-3-6-13(12)11-14/h2-3,5-6,14,16H,4,7-11H2,1H3 |
| InChIKey | IEBVTIUXXMTGHD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |