C15H29NO4S — CID 115919099
methyl 4-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]butanoate (PubChem CID 115919099) has the molecular formula C15H29NO4S and a molecular weight of 319.47 g/mol. Its IUPAC name is methyl 4-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 115919099 |
| Molecular Formula | C15H29NO4S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | methyl 4-[(3,3,5,5-tetramethylcyclohexyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H29NO4S/c1-14(2)9-12(10-15(3,4)11-14)16-21(18,19)8-6-7-13(17)20-5/h12,16H,6-11H2,1-5H3 |
| InChIKey | HPHYLKWYJJLNBO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |