C14H28ClNO2S — CID 116816465
4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)butane-1-sulfonamide (PubChem CID 116816465) has the molecular formula C14H28ClNO2S and a molecular weight of 309.90 g/mol. Its IUPAC name is 4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116816465 |
| Molecular Formula | C14H28ClNO2S |
| Molecular Weight | 309.90 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-chloro-N-(3,3,5,5-tetramethylcyclohexyl)butane-1-sulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)CCCCCl)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28ClNO2S/c1-13(2)9-12(10-14(3,4)11-13)16-19(17,18)8-6-5-7-15/h12,16H,5-11H2,1-4H3 |
| InChIKey | FPIOEAGVRPRJCS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|