C11H23NO3S — CID 115881104
N-(3,3-dimethylcyclopentyl)-3-methoxypropane-1-sulfonamide (PubChem CID 115881104) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-3-methoxypropane-1-sulfonamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-3-methoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 115881104 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-3-methoxypropane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C11H23NO3S/c1-11(2)6-5-10(9-11)12-16(13,14)8-4-7-15-3/h10,12H,4-9H2,1-3H3 |
| InChIKey | SSSJRYNWONPXDM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|