C11H22ClNO2S — CID 114550633
3-chloro-N-(3,3-dimethylcyclopentyl)-2-methylpropane-1-sulfonamide (PubChem CID 114550633) has the molecular formula C11H22ClNO2S and a molecular weight of 267.82 g/mol. Its IUPAC name is 3-chloro-N-(3,3-dimethylcyclopentyl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(3,3-dimethylcyclopentyl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 114550633 |
| Molecular Formula | C11H22ClNO2S |
| Molecular Weight | 267.82 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 3-chloro-N-(3,3-dimethylcyclopentyl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C11H22ClNO2S/c1-9(7-12)8-16(14,15)13-10-4-5-11(2,3)6-10/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | ZROYEJWAXKADJW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|