C10H21ClN2O4S2 — CID 79586175
3-chloro-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propane-1-sulfonamide (PubChem CID 79586175) has the molecular formula C10H21ClN2O4S2 and a molecular weight of 332.88 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 79586175 |
| Molecular Formula | C10H21ClN2O4S2 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-chloro-2-methyl-N-(1-methylsulfonylpiperidin-4-yl)propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H21ClN2O4S2/c1-9(7-11)8-19(16,17)12-10-3-5-13(6-4-10)18(2,14)15/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | QEHSOMLTMYQJSF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|