C7H16ClNO4S — CID 79588967
3-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methylpropane-1-sulfonamide (PubChem CID 79588967) has the molecular formula C7H16ClNO4S and a molecular weight of 245.73 g/mol. Its IUPAC name is 3-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79588967 |
| Molecular Formula | C7H16ClNO4S |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-chloro-N-(1,3-dihydroxypropan-2-yl)-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NC(CO)CO |
| InChI | InChI=1S/C7H16ClNO4S/c1-6(2-8)5-14(12,13)9-7(3-10)4-11/h6-7,9-11H,2-5H2,1H3 |
| InChIKey | VCSYRUYMQSLXAP-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|