C12H19NO4S — CID 80686550
N-(1,3-dihydroxypropan-2-yl)-2-phenylpropane-1-sulfonamide (PubChem CID 80686550) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2-phenylpropane-1-sulfonamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 80686550 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2-phenylpropane-1-sulfonamide |
| SMILES | CC(CS(=O)(=O)NC(CO)CO)c1ccccc1 |
| InChI | InChI=1S/C12H19NO4S/c1-10(11-5-3-2-4-6-11)9-18(16,17)13-12(7-14)8-15/h2-6,10,12-15H,7-9H2,1H3 |
| InChIKey | BSCLACIXCATYAS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |