C13H19NO5S — CID 104935033
(2S)-4-hydroxy-2-(2-phenylpropylsulfonylamino)butanoic acid (PubChem CID 104935033) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-(2-phenylpropylsulfonylamino)butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-(2-phenylpropylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 104935033 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2S)-4-hydroxy-2-(2-phenylpropylsulfonylamino)butanoic acid |
| SMILES | CC(CS(=O)(=O)N[C@@H](CCO)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO5S/c1-10(11-5-3-2-4-6-11)9-20(18,19)14-12(7-8-15)13(16)17/h2-6,10,12,14-15H,7-9H2,1H3,(H,16,17)/t10?,12-/m0/s1 |
| InChIKey | YAFOTPNPUQKQBB-KFJBMODSSA-N |
| XLogP | 0.55 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |