C13H18N2O5S — CID 80690279
(2S)-4-amino-4-oxo-2-(2-phenylpropylsulfonylamino)butanoic acid (PubChem CID 80690279) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-(2-phenylpropylsulfonylamino)butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-(2-phenylpropylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 80690279 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-(2-phenylpropylsulfonylamino)butanoic acid |
| SMILES | CC(CS(=O)(=O)N[C@@H](CC(N)=O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O5S/c1-9(10-5-3-2-4-6-10)8-21(19,20)15-11(13(17)18)7-12(14)16/h2-6,9,11,15H,7-8H2,1H3,(H2,14,16)(H,17,18)/t9?,11-/m0/s1 |
| InChIKey | XXCGPGXAPFFONN-UMJHXOGRSA-N |
| XLogP | 0.04 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |