C8H18ClNO2S — CID 79579871
N-tert-butyl-3-chloro-2-methylpropane-1-sulfonamide (PubChem CID 79579871) has the molecular formula C8H18ClNO2S and a molecular weight of 227.76 g/mol. Its IUPAC name is N-tert-butyl-3-chloro-2-methylpropane-1-sulfonamide.
| Compound Name | N-tert-butyl-3-chloro-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79579871 |
| Molecular Formula | C8H18ClNO2S |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-tert-butyl-3-chloro-2-methylpropane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C8H18ClNO2S/c1-7(5-9)6-13(11,12)10-8(2,3)4/h7,10H,5-6H2,1-4H3 |
| InChIKey | KRGWUCZAHYZMLX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|