C16H36N2O4S2 — CID 163730626
N-tert-butyl-1-cyclopropylmethanesulfonamide;N-tert-butyl-2-methylpropane-1-sulfonamide (PubChem CID 163730626) has the molecular formula C16H36N2O4S2 and a molecular weight of 384.61 g/mol. Its IUPAC name is N-tert-butyl-1-cyclopropylmethanesulfonamide;N-tert-butyl-2-methylpropane-1-sulfonamide.
| Compound Name | N-tert-butyl-1-cyclopropylmethanesulfonamide;N-tert-butyl-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 163730626 |
| Molecular Formula | C16H36N2O4S2 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-tert-butyl-1-cyclopropylmethanesulfonamide;N-tert-butyl-2-methylpropane-1-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CC1CC1.CC(C)CS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C8H17NO2S.C8H19NO2S/c1-8(2,3)9-12(10,11)6-7-4-5-7;1-7(2)6-12(10,11)9-8(3,4)5/h7,9H,4-6H2,1-3H3;7,9H,6H2,1-5H3 |
| InChIKey | KZGBLMPAIAODDA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |