C9H17Cl2NO2S — CID 107868369
N-[1-chloro-2-(chloromethyl)butan-2-yl]-1-cyclopropylmethanesulfonamide (PubChem CID 107868369) has the molecular formula C9H17Cl2NO2S and a molecular weight of 274.21 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-1-cyclopropylmethanesulfonamide.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-1-cyclopropylmethanesulfonamide |
|---|---|
| PubChem CID | 107868369 |
| Molecular Formula | C9H17Cl2NO2S |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-1-cyclopropylmethanesulfonamide |
| SMILES | CCC(CCl)(CCl)NS(=O)(=O)CC1CC1 |
| InChI | InChI=1S/C9H17Cl2NO2S/c1-2-9(6-10,7-11)12-15(13,14)5-8-3-4-8/h8,12H,2-7H2,1H3 |
| InChIKey | DTHAAWKAEUXICO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|