C11H23NO3S — CID 61453787
1-cyclohexyl-N-(1-hydroxy-2-methylpropan-2-yl)methanesulfonamide (PubChem CID 61453787) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-cyclohexyl-N-(1-hydroxy-2-methylpropan-2-yl)methanesulfonamide.
| Compound Name | 1-cyclohexyl-N-(1-hydroxy-2-methylpropan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 61453787 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-cyclohexyl-N-(1-hydroxy-2-methylpropan-2-yl)methanesulfonamide |
| SMILES | CC(C)(CO)NS(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C11H23NO3S/c1-11(2,9-13)12-16(14,15)8-10-6-4-3-5-7-10/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | FYPLVQKZFHBQDK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |