C13H25NO4S — CID 114285500
4-(cyclohexylmethylsulfonylamino)-2,2-dimethylbutanoic acid (PubChem CID 114285500) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is 4-(cyclohexylmethylsulfonylamino)-2,2-dimethylbutanoic acid.
| Compound Name | 4-(cyclohexylmethylsulfonylamino)-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 114285500 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-(cyclohexylmethylsulfonylamino)-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCNS(=O)(=O)CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C13H25NO4S/c1-13(2,12(15)16)8-9-14-19(17,18)10-11-6-4-3-5-7-11/h11,14H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | JQVGDIRVDUEUSR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |