C11H23NO4S — CID 62967339
1-cyclohexyl-N-(2,2-dimethoxyethyl)methanesulfonamide (PubChem CID 62967339) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is 1-cyclohexyl-N-(2,2-dimethoxyethyl)methanesulfonamide.
| Compound Name | 1-cyclohexyl-N-(2,2-dimethoxyethyl)methanesulfonamide |
|---|---|
| PubChem CID | 62967339 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-cyclohexyl-N-(2,2-dimethoxyethyl)methanesulfonamide |
| SMILES | COC(CNS(=O)(=O)CC1CCCCC1)OC |
| InChI | InChI=1S/C11H23NO4S/c1-15-11(16-2)8-12-17(13,14)9-10-6-4-3-5-7-10/h10-12H,3-9H2,1-2H3 |
| InChIKey | BSTXJIWONGRSKA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|