C11H24ClNO2S — CID 83146748
3-chloro-2-methyl-N-(2,3,3-trimethylbutyl)propane-1-sulfonamide (PubChem CID 83146748) has the molecular formula C11H24ClNO2S and a molecular weight of 269.84 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(2,3,3-trimethylbutyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-(2,3,3-trimethylbutyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 83146748 |
| Molecular Formula | C11H24ClNO2S |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-chloro-2-methyl-N-(2,3,3-trimethylbutyl)propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)NCC(C)C(C)(C)C |
| InChI | InChI=1S/C11H24ClNO2S/c1-9(6-12)8-16(14,15)13-7-10(2)11(3,4)5/h9-10,13H,6-8H2,1-5H3 |
| InChIKey | IUSZCYDDVDCGHA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|