C8H16ClNO4S — CID 79586207
methyl (2S)-2-[(3-chloro-2-methylpropyl)sulfonylamino]propanoate (PubChem CID 79586207) has the molecular formula C8H16ClNO4S and a molecular weight of 257.74 g/mol. Its IUPAC name is methyl (2S)-2-[(3-chloro-2-methylpropyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-2-[(3-chloro-2-methylpropyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 79586207 |
| Molecular Formula | C8H16ClNO4S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl (2S)-2-[(3-chloro-2-methylpropyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NS(=O)(=O)CC(C)CCl |
| InChI | InChI=1S/C8H16ClNO4S/c1-6(4-9)5-15(12,13)10-7(2)8(11)14-3/h6-7,10H,4-5H2,1-3H3/t6?,7-/m0/s1 |
| InChIKey | GIBLVBDPZONXKC-MLWJPKLSSA-N |
| XLogP | 0.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|