C7H13NO6S — CID 61455040
2-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]propanoic acid (PubChem CID 61455040) has the molecular formula C7H13NO6S and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]propanoic acid.
| Compound Name | 2-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 61455040 |
| Molecular Formula | C7H13NO6S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]propanoic acid |
| SMILES | COC(=O)[C@H](C)NS(=O)(=O)C(C)C(=O)O |
| InChI | InChI=1S/C7H13NO6S/c1-4(7(11)14-3)8-15(12,13)5(2)6(9)10/h4-5,8H,1-3H3,(H,9,10)/t4-,5?/m0/s1 |
| InChIKey | SULWVOYJTALGKA-ROLXFIACSA-N |
| XLogP | -1.06 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |