About 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid
2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid (PubChem CID 54951162) has the molecular formula C10H19NO6S
and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid |
| PubChem CID | 54951162 |
| Molecular Formula | C10H19NO6S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid |
| SMILES | COC(=O)C(C)S(=O)(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO6S/c1-6(9(14)17-5)18(15,16)11-7(8(12)13)10(2,3)4/h6-7,11H,1-5H3,(H,12,13) |
| InChIKey | RUTKNLLWHCZTSD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid?
The IUPAC name of 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid (CID 54951162) is 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid is COC(=O)C(C)S(=O)(=O)NC(C(=O)O)C(C)(C)C.
What is the InChIKey of 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid?
The InChIKey is RUTKNLLWHCZTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO6S/c1-6(9(14)17-5)18(15,16)11-7(8(12)13)10(2,3)4/h6-7,11H,1-5H3,(H,12,13).
What are the key properties of 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid?
2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid has a molecular weight of 281.33 g/mol, XLogP of -0.03, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 54951162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).