C8H15NO7S — CID 107824107
(2R)-4-hydroxy-2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]butanoic acid (PubChem CID 107824107) has the molecular formula C8H15NO7S and a molecular weight of 269.27 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 107824107 |
| Molecular Formula | C8H15NO7S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (2R)-4-hydroxy-2-[(1-methoxy-1-oxopropan-2-yl)sulfonylamino]butanoic acid |
| SMILES | COC(=O)C(C)S(=O)(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C8H15NO7S/c1-5(8(13)16-2)17(14,15)9-6(3-4-10)7(11)12/h5-6,9-10H,3-4H2,1-2H3,(H,11,12)/t5?,6-/m1/s1 |
| InChIKey | IBJUGVWAJABOHR-PRJDIBJQSA-N |
| XLogP | -1.70 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |