C8H14N2O5S — CID 107824113
(2R)-2-(1-cyanopropylsulfonylamino)-4-hydroxybutanoic acid (PubChem CID 107824113) has the molecular formula C8H14N2O5S and a molecular weight of 250.28 g/mol. Its IUPAC name is (2R)-2-(1-cyanopropylsulfonylamino)-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-(1-cyanopropylsulfonylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107824113 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (2R)-2-(1-cyanopropylsulfonylamino)-4-hydroxybutanoic acid |
| SMILES | CCC(C#N)S(=O)(=O)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C8H14N2O5S/c1-2-6(5-9)16(14,15)10-7(3-4-11)8(12)13/h6-7,10-11H,2-4H2,1H3,(H,12,13)/t6?,7-/m1/s1 |
| InChIKey | JEJDHCFXKSHPQA-COBSHVIPSA-N |
| XLogP | -0.96 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |