C5H8F3NO5S — CID 107824076
(2R)-4-hydroxy-2-(trifluoromethylsulfonylamino)butanoic acid (PubChem CID 107824076) has the molecular formula C5H8F3NO5S and a molecular weight of 251.18 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-(trifluoromethylsulfonylamino)butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-(trifluoromethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 107824076 |
| Molecular Formula | C5H8F3NO5S |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | (2R)-4-hydroxy-2-(trifluoromethylsulfonylamino)butanoic acid |
| SMILES | O=C(O)[C@@H](CCO)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO5S/c6-5(7,8)15(13,14)9-3(1-2-10)4(11)12/h3,9-10H,1-2H2,(H,11,12)/t3-/m1/s1 |
| InChIKey | HDRQHIOFLKSZJR-GSVOUGTGSA-N |
| XLogP | -0.74 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |