C8H15NO6 — CID 155788210
2-[(1-carboxy-3-hydroxypropyl)amino]-4-hydroxybutanoic acid (PubChem CID 155788210) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-[(1-carboxy-3-hydroxypropyl)amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[(1-carboxy-3-hydroxypropyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 155788210 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-[(1-carboxy-3-hydroxypropyl)amino]-4-hydroxybutanoic acid |
| SMILES | O=C(O)C(CCO)NC(CCO)C(=O)O |
| InChI | InChI=1S/C8H15NO6/c10-3-1-5(7(12)13)9-6(2-4-11)8(14)15/h5-6,9-11H,1-4H2,(H,12,13)(H,14,15) |
| InChIKey | SVJAMNNMWGJRIZ-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |