(2S)-2-hydrazinyl-4-hydroxybutanoic acid

C4H10N2O3 — CID 150765964

IUPAC(2S)-2-hydrazinyl-4-hydroxybutanoic acid
SMILESNN[C@@H](CCO)C(=O)O
InChIInChI=1S/C4H10N2O3/c5-6-3(1-2-7)4(8)9/h3,6-7H,1-2,5H2,(H,8,9)/t3-/m0/s1
InChIKeyJYVIOCPYJUIEIM-VKHMYHEASA-N
MW134.14 g/mol
LogP-1.71
Rot. Bonds4

About (2S)-2-hydrazinyl-4-hydroxybutanoic acid

(2S)-2-hydrazinyl-4-hydroxybutanoic acid (PubChem CID 150765964) has the molecular formula C4H10N2O3 and a molecular weight of 134.14 g/mol. Its IUPAC name is (2S)-2-hydrazinyl-4-hydroxybutanoic acid.

Molecular Properties

Compound Name(2S)-2-hydrazinyl-4-hydroxybutanoic acid
PubChem CID150765964
Molecular FormulaC4H10N2O3
Molecular Weight134.14 g/mol
Exact Mass134.07
IUPAC Name(2S)-2-hydrazinyl-4-hydroxybutanoic acid
SMILESNN[C@@H](CCO)C(=O)O
InChIInChI=1S/C4H10N2O3/c5-6-3(1-2-7)4(8)9/h3,6-7H,1-2,5H2,(H,8,9)/t3-/m0/s1
InChIKeyJYVIOCPYJUIEIM-VKHMYHEASA-N
XLogP-1.71
TPSA95.58 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500134.14
LogP ≤ 5-1.71
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2S)-2-hydrazinyl-4-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(1-carboxy-3-hydroxypropyl)amino]-4-hydroxybutanoic acid
CID 155788210
ethane;(3S)-3-hydrazinyl-5-hydroxypentan-2-one
CID 145050521
2-[(2-aminoacetyl)amino]-4-hydroxybutanoic acid
CID 61244410
(2S)-2-hydrazinylheptanoic acid
CID 118266927
2-hydrazinyloctanedioic acid
CID 150661126
(2S)-5-amino-2-hydrazinyl-5-hydroxyiminopentanoic acid
CID 150696785
(2S)-4-hydroxy-2-(prop-2-enoxycarbonylamino)butanoic acid
CID 103845923
(2S)-4-azido-2-hydrazinylbutanoic acid
CID 89379573
2-[[(2R)-2-aminopropanoyl]amino]-4-hydroxybutanoic acid
CID 78973168
2-(tert-butylamino)-4-hydroxybutanoic acid
CID 83695715
(2R)-4-hydroxy-2-(methylcarbamoylamino)butanoic acid
CID 91507162
(2S)-4-hydroxy-2-[(2-sulfanylacetyl)amino]butanoic acid
CID 91260947

Frequently Asked Questions

What is the IUPAC name of (2S)-2-hydrazinyl-4-hydroxybutanoic acid?
The IUPAC name of (2S)-2-hydrazinyl-4-hydroxybutanoic acid (CID 150765964) is (2S)-2-hydrazinyl-4-hydroxybutanoic acid.
What is the SMILES notation for (2S)-2-hydrazinyl-4-hydroxybutanoic acid?
The canonical SMILES for (2S)-2-hydrazinyl-4-hydroxybutanoic acid is NN[C@@H](CCO)C(=O)O.
What is the InChIKey of (2S)-2-hydrazinyl-4-hydroxybutanoic acid?
The InChIKey is JYVIOCPYJUIEIM-VKHMYHEASA-N. The full InChI is InChI=1S/C4H10N2O3/c5-6-3(1-2-7)4(8)9/h3,6-7H,1-2,5H2,(H,8,9)/t3-/m0/s1.
What are the key properties of (2S)-2-hydrazinyl-4-hydroxybutanoic acid?
(2S)-2-hydrazinyl-4-hydroxybutanoic acid has a molecular weight of 134.14 g/mol, XLogP of -1.71, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-hydrazinyl-4-hydroxybutanoic acid is sourced from PubChem (CID 150765964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).