C5H12N4O3 — CID 150696785
(2S)-5-amino-2-hydrazinyl-5-hydroxyiminopentanoic acid (PubChem CID 150696785) has the molecular formula C5H12N4O3 and a molecular weight of 176.18 g/mol. Its IUPAC name is (2S)-5-amino-2-hydrazinyl-5-hydroxyiminopentanoic acid.
| Compound Name | (2S)-5-amino-2-hydrazinyl-5-hydroxyiminopentanoic acid |
|---|---|
| PubChem CID | 150696785 |
| Molecular Formula | C5H12N4O3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | (2S)-5-amino-2-hydrazinyl-5-hydroxyiminopentanoic acid |
| SMILES | NN[C@@H](CCC(N)=NO)C(=O)O |
| InChI | InChI=1S/C5H12N4O3/c6-4(9-12)2-1-3(8-7)5(10)11/h3,8,12H,1-2,7H2,(H2,6,9)(H,10,11)/t3-/m0/s1 |
| InChIKey | JKZYZGPVXPOTJU-VKHMYHEASA-N |
| XLogP | -1.57 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|