About (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid
(3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid (PubChem CID 158833017) has the molecular formula C6H12N4O6
and a molecular weight of 236.18 g/mol. Its IUPAC name is (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid.
Molecular Properties
| Compound Name | (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid |
| PubChem CID | 158833017 |
| Molecular Formula | C6H12N4O6 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid |
| SMILES | N/C(CC(=O)O)=N/O.N/C(CC(=O)O)=N\O |
| InChI | InChI=1S/2C3H6N2O3/c2*4-2(5-8)1-3(6)7/h2*8H,1H2,(H2,4,5)(H,6,7) |
| InChIKey | IXHAJIXUDJVSTA-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 191.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid?
The IUPAC name of (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid (CID 158833017) is (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid.
What is the SMILES notation for (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid?
The canonical SMILES for (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid is N/C(CC(=O)O)=N/O.N/C(CC(=O)O)=N\O.
What is the InChIKey of (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid?
The InChIKey is IXHAJIXUDJVSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H6N2O3/c2*4-2(5-8)1-3(6)7/h2*8H,1H2,(H2,4,5)(H,6,7).
What are the key properties of (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid?
(3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid has a molecular weight of 236.18 g/mol, XLogP of -1.59, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-amino-3-hydroxyiminopropanoic acid;(3Z)-3-amino-3-hydroxyiminopropanoic acid is sourced from PubChem (CID 158833017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).