About 3-amino-3-oxopropanoic acid;sulfane
3-amino-3-oxopropanoic acid;sulfane (PubChem CID 175305648) has the molecular formula C3H7NO3S
and a molecular weight of 137.16 g/mol. Its IUPAC name is 3-amino-3-oxopropanoic acid;sulfane.
Molecular Properties
| Compound Name | 3-amino-3-oxopropanoic acid;sulfane |
| PubChem CID | 175305648 |
| Molecular Formula | C3H7NO3S |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.01 |
| IUPAC Name | 3-amino-3-oxopropanoic acid;sulfane |
| SMILES | NC(=O)CC(=O)O.S |
| InChI | InChI=1S/C3H5NO3.H2S/c4-2(5)1-3(6)7;/h1H2,(H2,4,5)(H,6,7);1H2 |
| InChIKey | KKKONOJGRDTCIS-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3-oxopropanoic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-oxopropanoic acid;sulfane?
The IUPAC name of 3-amino-3-oxopropanoic acid;sulfane (CID 175305648) is 3-amino-3-oxopropanoic acid;sulfane.
What is the SMILES notation for 3-amino-3-oxopropanoic acid;sulfane?
The canonical SMILES for 3-amino-3-oxopropanoic acid;sulfane is NC(=O)CC(=O)O.S.
What is the InChIKey of 3-amino-3-oxopropanoic acid;sulfane?
The InChIKey is KKKONOJGRDTCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO3.H2S/c4-2(5)1-3(6)7;/h1H2,(H2,4,5)(H,6,7);1H2.
What are the key properties of 3-amino-3-oxopropanoic acid;sulfane?
3-amino-3-oxopropanoic acid;sulfane has a molecular weight of 137.16 g/mol, XLogP of -0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-oxopropanoic acid;sulfane is sourced from PubChem (CID 175305648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).