About propanamide;propanedioic acid
propanamide;propanedioic acid (PubChem CID 174420039) has the molecular formula C9H18N2O6
and a molecular weight of 250.25 g/mol. Its IUPAC name is propanamide;propanedioic acid.
Molecular Properties
| Compound Name | propanamide;propanedioic acid |
| PubChem CID | 174420039 |
| Molecular Formula | C9H18N2O6 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | propanamide;propanedioic acid |
| SMILES | CCC(N)=O.CCC(N)=O.O=C(O)CC(=O)O |
| InChI | InChI=1S/2C3H7NO.C3H4O4/c2*1-2-3(4)5;4-2(5)1-3(6)7/h2*2H2,1H3,(H2,4,5);1H2,(H,4,5)(H,6,7) |
| InChIKey | UHCSXTABIUCZBV-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanamide;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;propanedioic acid?
The IUPAC name of propanamide;propanedioic acid (CID 174420039) is propanamide;propanedioic acid.
What is the SMILES notation for propanamide;propanedioic acid?
The canonical SMILES for propanamide;propanedioic acid is CCC(N)=O.CCC(N)=O.O=C(O)CC(=O)O.
What is the InChIKey of propanamide;propanedioic acid?
The InChIKey is UHCSXTABIUCZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7NO.C3H4O4/c2*1-2-3(4)5;4-2(5)1-3(6)7/h2*2H2,1H3,(H2,4,5);1H2,(H,4,5)(H,6,7).
What are the key properties of propanamide;propanedioic acid?
propanamide;propanedioic acid has a molecular weight of 250.25 g/mol, XLogP of -0.69, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;propanedioic acid is sourced from PubChem (CID 174420039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).