About methane;propanamide
methane;propanamide (PubChem CID 160666730) has the molecular formula C5H15NO
and a molecular weight of 105.18 g/mol. Its IUPAC name is methane;propanamide.
Molecular Properties
| Compound Name | methane;propanamide |
| PubChem CID | 160666730 |
| Molecular Formula | C5H15NO |
| Molecular Weight | 105.18 g/mol |
| Exact Mass | 105.12 |
| IUPAC Name | methane;propanamide |
| SMILES | C.C.CCC(N)=O |
| InChI | InChI=1S/C3H7NO.2CH4/c1-2-3(4)5;;/h2H2,1H3,(H2,4,5);2*1H4 |
| InChIKey | RMKALGZFERZGSE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;propanamide?
The IUPAC name of methane;propanamide (CID 160666730) is methane;propanamide.
What is the SMILES notation for methane;propanamide?
The canonical SMILES for methane;propanamide is C.C.CCC(N)=O.
What is the InChIKey of methane;propanamide?
The InChIKey is RMKALGZFERZGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.2CH4/c1-2-3(4)5;;/h2H2,1H3,(H2,4,5);2*1H4.
What are the key properties of methane;propanamide?
methane;propanamide has a molecular weight of 105.18 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;propanamide is sourced from PubChem (CID 160666730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).