About propanamide;propan-1-amine
propanamide;propan-1-amine (PubChem CID 118437692) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is propanamide;propan-1-amine.
Molecular Properties
| Compound Name | propanamide;propan-1-amine |
| PubChem CID | 118437692 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | propanamide;propan-1-amine |
| SMILES | CCC(N)=O.CCCN |
| InChI | InChI=1S/C3H7NO.C3H9N/c1-2-3(4)5;1-2-3-4/h2H2,1H3,(H2,4,5);2-4H2,1H3 |
| InChIKey | BLOBILBSHCUWKC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propanamide;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;propan-1-amine?
The IUPAC name of propanamide;propan-1-amine (CID 118437692) is propanamide;propan-1-amine.
What is the SMILES notation for propanamide;propan-1-amine?
The canonical SMILES for propanamide;propan-1-amine is CCC(N)=O.CCCN.
What is the InChIKey of propanamide;propan-1-amine?
The InChIKey is BLOBILBSHCUWKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C3H9N/c1-2-3(4)5;1-2-3-4/h2H2,1H3,(H2,4,5);2-4H2,1H3.
What are the key properties of propanamide;propan-1-amine?
propanamide;propan-1-amine has a molecular weight of 132.21 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;propan-1-amine is sourced from PubChem (CID 118437692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).