About propanamide;bis(propan-1-amine)
propanamide;bis(propan-1-amine) (PubChem CID 158390031) has the molecular formula C9H25N3O
and a molecular weight of 191.32 g/mol. Its IUPAC name is propanamide;bis(propan-1-amine).
Molecular Properties
| Compound Name | propanamide;bis(propan-1-amine) |
| PubChem CID | 158390031 |
| Molecular Formula | C9H25N3O |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.20 |
| IUPAC Name | propanamide;bis(propan-1-amine) |
| SMILES | CCC(N)=O.CCCN.CCCN |
| InChI | InChI=1S/C3H7NO.2C3H9N/c1-2-3(4)5;2*1-2-3-4/h2H2,1H3,(H2,4,5);2*2-4H2,1H3 |
| InChIKey | GWVNOFUITXFGJM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propanamide;bis(propan-1-amine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;bis(propan-1-amine)?
The IUPAC name of propanamide;bis(propan-1-amine) (CID 158390031) is propanamide;bis(propan-1-amine).
What is the SMILES notation for propanamide;bis(propan-1-amine)?
The canonical SMILES for propanamide;bis(propan-1-amine) is CCC(N)=O.CCCN.CCCN.
What is the InChIKey of propanamide;bis(propan-1-amine)?
The InChIKey is GWVNOFUITXFGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.2C3H9N/c1-2-3(4)5;2*1-2-3-4/h2H2,1H3,(H2,4,5);2*2-4H2,1H3.
What are the key properties of propanamide;bis(propan-1-amine)?
propanamide;bis(propan-1-amine) has a molecular weight of 191.32 g/mol, XLogP of 0.59, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;bis(propan-1-amine) is sourced from PubChem (CID 158390031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).