About propanamide;trichloroalumane
propanamide;trichloroalumane (PubChem CID 174958610) has the molecular formula C3H7AlCl3NO
and a molecular weight of 206.44 g/mol. Its IUPAC name is propanamide;trichloroalumane.
Molecular Properties
| Compound Name | propanamide;trichloroalumane |
| PubChem CID | 174958610 |
| Molecular Formula | C3H7AlCl3NO |
| Molecular Weight | 206.44 g/mol |
| Exact Mass | 204.94 |
| IUPAC Name | propanamide;trichloroalumane |
| SMILES | CCC(N)=O.Cl[Al](Cl)Cl |
| InChI | InChI=1S/C3H7NO.Al.3ClH/c1-2-3(4)5;;;;/h2H2,1H3,(H2,4,5);;3*1H/q;+3;;;/p-3 |
| InChIKey | PSPPABUGGDKWJD-UHFFFAOYSA-K |
| XLogP | 1.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanamide;trichloroalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;trichloroalumane?
The IUPAC name of propanamide;trichloroalumane (CID 174958610) is propanamide;trichloroalumane.
What is the SMILES notation for propanamide;trichloroalumane?
The canonical SMILES for propanamide;trichloroalumane is CCC(N)=O.Cl[Al](Cl)Cl.
What is the InChIKey of propanamide;trichloroalumane?
The InChIKey is PSPPABUGGDKWJD-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H7NO.Al.3ClH/c1-2-3(4)5;;;;/h2H2,1H3,(H2,4,5);;3*1H/q;+3;;;/p-3.
What are the key properties of propanamide;trichloroalumane?
propanamide;trichloroalumane has a molecular weight of 206.44 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;trichloroalumane is sourced from PubChem (CID 174958610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).