About propanoyl chloride;urea
propanoyl chloride;urea (PubChem CID 174974689) has the molecular formula C4H9ClN2O2
and a molecular weight of 152.58 g/mol. Its IUPAC name is propanoyl chloride;urea.
Molecular Properties
| Compound Name | propanoyl chloride;urea |
| PubChem CID | 174974689 |
| Molecular Formula | C4H9ClN2O2 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | propanoyl chloride;urea |
| SMILES | CCC(=O)Cl.NC(N)=O |
| InChI | InChI=1S/C3H5ClO.CH4N2O/c1-2-3(4)5;2-1(3)4/h2H2,1H3;(H4,2,3,4) |
| InChIKey | YTJCXLKVINNMCB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze propanoyl chloride;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl chloride;urea?
The IUPAC name of propanoyl chloride;urea (CID 174974689) is propanoyl chloride;urea.
What is the SMILES notation for propanoyl chloride;urea?
The canonical SMILES for propanoyl chloride;urea is CCC(=O)Cl.NC(N)=O.
What is the InChIKey of propanoyl chloride;urea?
The InChIKey is YTJCXLKVINNMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO.CH4N2O/c1-2-3(4)5;2-1(3)4/h2H2,1H3;(H4,2,3,4).
What are the key properties of propanoyl chloride;urea?
propanoyl chloride;urea has a molecular weight of 152.58 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl chloride;urea is sourced from PubChem (CID 174974689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).