About propanamide;hydrate;hydrochloride
propanamide;hydrate;hydrochloride (PubChem CID 19791604) has the molecular formula C3H10ClNO2
and a molecular weight of 127.57 g/mol. Its IUPAC name is propanamide;hydrate;hydrochloride.
Molecular Properties
| Compound Name | propanamide;hydrate;hydrochloride |
| PubChem CID | 19791604 |
| Molecular Formula | C3H10ClNO2 |
| Molecular Weight | 127.57 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | propanamide;hydrate;hydrochloride |
| SMILES | CCC(N)=O.Cl.O |
| InChI | InChI=1S/C3H7NO.ClH.H2O/c1-2-3(4)5;;/h2H2,1H3,(H2,4,5);1H;1H2 |
| InChIKey | ATUNAYSDASMSTQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.57 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanamide;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;hydrate;hydrochloride?
The IUPAC name of propanamide;hydrate;hydrochloride (CID 19791604) is propanamide;hydrate;hydrochloride.
What is the SMILES notation for propanamide;hydrate;hydrochloride?
The canonical SMILES for propanamide;hydrate;hydrochloride is CCC(N)=O.Cl.O.
What is the InChIKey of propanamide;hydrate;hydrochloride?
The InChIKey is ATUNAYSDASMSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.ClH.H2O/c1-2-3(4)5;;/h2H2,1H3,(H2,4,5);1H;1H2.
What are the key properties of propanamide;hydrate;hydrochloride?
propanamide;hydrate;hydrochloride has a molecular weight of 127.57 g/mol, XLogP of -0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;hydrate;hydrochloride is sourced from PubChem (CID 19791604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).