About guanidine;propanamide
guanidine;propanamide (PubChem CID 158320139) has the molecular formula C4H12N4O
and a molecular weight of 132.17 g/mol. Its IUPAC name is guanidine;propanamide.
Molecular Properties
| Compound Name | guanidine;propanamide |
| PubChem CID | 158320139 |
| Molecular Formula | C4H12N4O |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | guanidine;propanamide |
| SMILES | CCC(N)=O.[H]N=C(N)N |
| InChI | InChI=1S/C3H7NO.CH5N3/c1-2-3(4)5;2-1(3)4/h2H2,1H3,(H2,4,5);(H5,2,3,4) |
| InChIKey | GOTAIIJHCGUCBR-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze guanidine;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;propanamide?
The IUPAC name of guanidine;propanamide (CID 158320139) is guanidine;propanamide.
What is the SMILES notation for guanidine;propanamide?
The canonical SMILES for guanidine;propanamide is CCC(N)=O.[H]N=C(N)N.
What is the InChIKey of guanidine;propanamide?
The InChIKey is GOTAIIJHCGUCBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.CH5N3/c1-2-3(4)5;2-1(3)4/h2H2,1H3,(H2,4,5);(H5,2,3,4).
What are the key properties of guanidine;propanamide?
guanidine;propanamide has a molecular weight of 132.17 g/mol, XLogP of -1.28, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;propanamide is sourced from PubChem (CID 158320139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).