About propanamide;thionyl dichloride
propanamide;thionyl dichloride (PubChem CID 161371403) has the molecular formula C3H7Cl2NO2S
and a molecular weight of 192.07 g/mol. Its IUPAC name is propanamide;thionyl dichloride.
Molecular Properties
| Compound Name | propanamide;thionyl dichloride |
| PubChem CID | 161371403 |
| Molecular Formula | C3H7Cl2NO2S |
| Molecular Weight | 192.07 g/mol |
| Exact Mass | 190.96 |
| IUPAC Name | propanamide;thionyl dichloride |
| SMILES | CCC(N)=O.O=S(Cl)Cl |
| InChI | InChI=1S/C3H7NO.Cl2OS/c1-2-3(4)5;1-4(2)3/h2H2,1H3,(H2,4,5); |
| InChIKey | VQMSJMGFEILRPS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.07 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propanamide;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanamide;thionyl dichloride?
The IUPAC name of propanamide;thionyl dichloride (CID 161371403) is propanamide;thionyl dichloride.
What is the SMILES notation for propanamide;thionyl dichloride?
The canonical SMILES for propanamide;thionyl dichloride is CCC(N)=O.O=S(Cl)Cl.
What is the InChIKey of propanamide;thionyl dichloride?
The InChIKey is VQMSJMGFEILRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.Cl2OS/c1-2-3(4)5;1-4(2)3/h2H2,1H3,(H2,4,5);.
What are the key properties of propanamide;thionyl dichloride?
propanamide;thionyl dichloride has a molecular weight of 192.07 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanamide;thionyl dichloride is sourced from PubChem (CID 161371403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).