About potassium;hydrogen sulfite;propanamide
potassium;hydrogen sulfite;propanamide (PubChem CID 174649785) has the molecular formula C3H8KNO4S
and a molecular weight of 193.26 g/mol. Its IUPAC name is potassium;hydrogen sulfite;propanamide.
Molecular Properties
| Compound Name | potassium;hydrogen sulfite;propanamide |
| PubChem CID | 174649785 |
| Molecular Formula | C3H8KNO4S |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | potassium;hydrogen sulfite;propanamide |
| SMILES | CCC(N)=O.O=S([O-])O.[K+] |
| InChI | InChI=1S/C3H7NO.K.H2O3S/c1-2-3(4)5;;1-4(2)3/h2H2,1H3,(H2,4,5);;(H2,1,2,3)/q;+1;/p-1 |
| InChIKey | QFGGZSFEVTYIDS-UHFFFAOYSA-M |
| XLogP | -3.78 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydrogen sulfite;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydrogen sulfite;propanamide?
The IUPAC name of potassium;hydrogen sulfite;propanamide (CID 174649785) is potassium;hydrogen sulfite;propanamide.
What is the SMILES notation for potassium;hydrogen sulfite;propanamide?
The canonical SMILES for potassium;hydrogen sulfite;propanamide is CCC(N)=O.O=S([O-])O.[K+].
What is the InChIKey of potassium;hydrogen sulfite;propanamide?
The InChIKey is QFGGZSFEVTYIDS-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.K.H2O3S/c1-2-3(4)5;;1-4(2)3/h2H2,1H3,(H2,4,5);;(H2,1,2,3)/q;+1;/p-1.
What are the key properties of potassium;hydrogen sulfite;propanamide?
potassium;hydrogen sulfite;propanamide has a molecular weight of 193.26 g/mol, XLogP of -3.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydrogen sulfite;propanamide is sourced from PubChem (CID 174649785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).