About potassium;acetic acid;hydrogen sulfite
potassium;acetic acid;hydrogen sulfite (PubChem CID 174668160) has the molecular formula C2H5KO5S
and a molecular weight of 180.22 g/mol. Its IUPAC name is potassium;acetic acid;hydrogen sulfite.
Molecular Properties
| Compound Name | potassium;acetic acid;hydrogen sulfite |
| PubChem CID | 174668160 |
| Molecular Formula | C2H5KO5S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 179.95 |
| IUPAC Name | potassium;acetic acid;hydrogen sulfite |
| SMILES | CC(=O)O.O=S([O-])O.[K+] |
| InChI | InChI=1S/C2H4O2.K.H2O3S/c1-2(3)4;;1-4(2)3/h1H3,(H,3,4);;(H2,1,2,3)/q;+1;/p-1 |
| InChIKey | VCIMESLDJOGGFY-UHFFFAOYSA-M |
| XLogP | -3.57 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze potassium;acetic acid;hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;acetic acid;hydrogen sulfite?
The IUPAC name of potassium;acetic acid;hydrogen sulfite (CID 174668160) is potassium;acetic acid;hydrogen sulfite.
What is the SMILES notation for potassium;acetic acid;hydrogen sulfite?
The canonical SMILES for potassium;acetic acid;hydrogen sulfite is CC(=O)O.O=S([O-])O.[K+].
What is the InChIKey of potassium;acetic acid;hydrogen sulfite?
The InChIKey is VCIMESLDJOGGFY-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.K.H2O3S/c1-2(3)4;;1-4(2)3/h1H3,(H,3,4);;(H2,1,2,3)/q;+1;/p-1.
What are the key properties of potassium;acetic acid;hydrogen sulfite?
potassium;acetic acid;hydrogen sulfite has a molecular weight of 180.22 g/mol, XLogP of -3.57, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;acetic acid;hydrogen sulfite is sourced from PubChem (CID 174668160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).