About ethane;hydrogen sulfite;2-methylprop-2-enoic acid
ethane;hydrogen sulfite;2-methylprop-2-enoic acid (PubChem CID 174520985) has the molecular formula C6H13O5S-
and a molecular weight of 197.23 g/mol. Its IUPAC name is ethane;hydrogen sulfite;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethane;hydrogen sulfite;2-methylprop-2-enoic acid |
| PubChem CID | 174520985 |
| Molecular Formula | C6H13O5S- |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | ethane;hydrogen sulfite;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC.O=S([O-])O |
| InChI | InChI=1S/C4H6O2.C2H6.H2O3S/c1-3(2)4(5)6;1-2;1-4(2)3/h1H2,2H3,(H,5,6);1-2H3;(H2,1,2,3)/p-1 |
| InChIKey | FGABPSXDRJSCGI-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethane;hydrogen sulfite;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hydrogen sulfite;2-methylprop-2-enoic acid?
The IUPAC name of ethane;hydrogen sulfite;2-methylprop-2-enoic acid (CID 174520985) is ethane;hydrogen sulfite;2-methylprop-2-enoic acid.
What is the SMILES notation for ethane;hydrogen sulfite;2-methylprop-2-enoic acid?
The canonical SMILES for ethane;hydrogen sulfite;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CC.O=S([O-])O.
What is the InChIKey of ethane;hydrogen sulfite;2-methylprop-2-enoic acid?
The InChIKey is FGABPSXDRJSCGI-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6O2.C2H6.H2O3S/c1-3(2)4(5)6;1-2;1-4(2)3/h1H2,2H3,(H,5,6);1-2H3;(H2,1,2,3)/p-1.
What are the key properties of ethane;hydrogen sulfite;2-methylprop-2-enoic acid?
ethane;hydrogen sulfite;2-methylprop-2-enoic acid has a molecular weight of 197.23 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hydrogen sulfite;2-methylprop-2-enoic acid is sourced from PubChem (CID 174520985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).