About propanoic acid;trihydrate;dihydrochloride
propanoic acid;trihydrate;dihydrochloride (PubChem CID 139667830) has the molecular formula C3H14Cl2O5
and a molecular weight of 201.05 g/mol. Its IUPAC name is propanoic acid;trihydrate;dihydrochloride.
Molecular Properties
| Compound Name | propanoic acid;trihydrate;dihydrochloride |
| PubChem CID | 139667830 |
| Molecular Formula | C3H14Cl2O5 |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | propanoic acid;trihydrate;dihydrochloride |
| SMILES | CCC(=O)O.Cl.Cl.O.O.O |
| InChI | InChI=1S/C3H6O2.2ClH.3H2O/c1-2-3(4)5;;;;;/h2H2,1H3,(H,4,5);2*1H;3*1H2 |
| InChIKey | VWROMUPDXDAMDK-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanoic acid;trihydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;trihydrate;dihydrochloride?
The IUPAC name of propanoic acid;trihydrate;dihydrochloride (CID 139667830) is propanoic acid;trihydrate;dihydrochloride.
What is the SMILES notation for propanoic acid;trihydrate;dihydrochloride?
The canonical SMILES for propanoic acid;trihydrate;dihydrochloride is CCC(=O)O.Cl.Cl.O.O.O.
What is the InChIKey of propanoic acid;trihydrate;dihydrochloride?
The InChIKey is VWROMUPDXDAMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.2ClH.3H2O/c1-2-3(4)5;;;;;/h2H2,1H3,(H,4,5);2*1H;3*1H2.
What are the key properties of propanoic acid;trihydrate;dihydrochloride?
propanoic acid;trihydrate;dihydrochloride has a molecular weight of 201.05 g/mol, XLogP of -1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;trihydrate;dihydrochloride is sourced from PubChem (CID 139667830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).