About propanoic acid;dihydrochloride
propanoic acid;dihydrochloride (PubChem CID 87391840) has the molecular formula C3H8Cl2O2
and a molecular weight of 147.00 g/mol. Its IUPAC name is propanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | propanoic acid;dihydrochloride |
| PubChem CID | 87391840 |
| Molecular Formula | C3H8Cl2O2 |
| Molecular Weight | 147.00 g/mol |
| Exact Mass | 145.99 |
| IUPAC Name | propanoic acid;dihydrochloride |
| SMILES | CCC(=O)O.Cl.Cl |
| InChI | InChI=1S/C3H6O2.2ClH/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);2*1H |
| InChIKey | FXSZGKYGUFCBQY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.00 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;dihydrochloride?
The IUPAC name of propanoic acid;dihydrochloride (CID 87391840) is propanoic acid;dihydrochloride.
What is the SMILES notation for propanoic acid;dihydrochloride?
The canonical SMILES for propanoic acid;dihydrochloride is CCC(=O)O.Cl.Cl.
What is the InChIKey of propanoic acid;dihydrochloride?
The InChIKey is FXSZGKYGUFCBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.2ClH/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);2*1H.
What are the key properties of propanoic acid;dihydrochloride?
propanoic acid;dihydrochloride has a molecular weight of 147.00 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;dihydrochloride is sourced from PubChem (CID 87391840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).