About indigane;propanoic acid
indigane;propanoic acid (PubChem CID 173208103) has the molecular formula C3H9InO2
and a molecular weight of 191.92 g/mol. Its IUPAC name is indigane;propanoic acid.
Molecular Properties
| Compound Name | indigane;propanoic acid |
| PubChem CID | 173208103 |
| Molecular Formula | C3H9InO2 |
| Molecular Weight | 191.92 g/mol |
| Exact Mass | 191.96 |
| IUPAC Name | indigane;propanoic acid |
| SMILES | CCC(=O)O.[InH3] |
| InChI | InChI=1S/C3H6O2.In.3H/c1-2-3(4)5;;;;/h2H2,1H3,(H,4,5);;;; |
| InChIKey | KGCCFCMQSACTAM-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.92 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze indigane;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indigane;propanoic acid?
The IUPAC name of indigane;propanoic acid (CID 173208103) is indigane;propanoic acid.
What is the SMILES notation for indigane;propanoic acid?
The canonical SMILES for indigane;propanoic acid is CCC(=O)O.[InH3].
What is the InChIKey of indigane;propanoic acid?
The InChIKey is KGCCFCMQSACTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.In.3H/c1-2-3(4)5;;;;/h2H2,1H3,(H,4,5);;;;.
What are the key properties of indigane;propanoic acid?
indigane;propanoic acid has a molecular weight of 191.92 g/mol, XLogP of -0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for indigane;propanoic acid is sourced from PubChem (CID 173208103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).