About chromium;propanoic acid
chromium;propanoic acid (PubChem CID 87085581) has the molecular formula C3H6CrO2
and a molecular weight of 126.07 g/mol. Its IUPAC name is chromium;propanoic acid.
Molecular Properties
| Compound Name | chromium;propanoic acid |
| PubChem CID | 87085581 |
| Molecular Formula | C3H6CrO2 |
| Molecular Weight | 126.07 g/mol |
| Exact Mass | 125.98 |
| IUPAC Name | chromium;propanoic acid |
| SMILES | CCC(=O)O.[Cr] |
| InChI | InChI=1S/C3H6O2.Cr/c1-2-3(4)5;/h2H2,1H3,(H,4,5); |
| InChIKey | DRMBDGKDZMWRIC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.07 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chromium;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;propanoic acid?
The IUPAC name of chromium;propanoic acid (CID 87085581) is chromium;propanoic acid.
What is the SMILES notation for chromium;propanoic acid?
The canonical SMILES for chromium;propanoic acid is CCC(=O)O.[Cr].
What is the InChIKey of chromium;propanoic acid?
The InChIKey is DRMBDGKDZMWRIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.Cr/c1-2-3(4)5;/h2H2,1H3,(H,4,5);.
What are the key properties of chromium;propanoic acid?
chromium;propanoic acid has a molecular weight of 126.07 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;propanoic acid is sourced from PubChem (CID 87085581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).