About copper;propanoic acid;hydrate
copper;propanoic acid;hydrate (PubChem CID 87996764) has the molecular formula C3H8CuO3
and a molecular weight of 155.64 g/mol. Its IUPAC name is copper;propanoic acid;hydrate.
Molecular Properties
| Compound Name | copper;propanoic acid;hydrate |
| PubChem CID | 87996764 |
| Molecular Formula | C3H8CuO3 |
| Molecular Weight | 155.64 g/mol |
| Exact Mass | 154.98 |
| IUPAC Name | copper;propanoic acid;hydrate |
| SMILES | CCC(=O)O.O.[Cu] |
| InChI | InChI=1S/C3H6O2.Cu.H2O/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;1H2 |
| InChIKey | JWSFDEVAAIOBFF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.64 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze copper;propanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;propanoic acid;hydrate?
The IUPAC name of copper;propanoic acid;hydrate (CID 87996764) is copper;propanoic acid;hydrate.
What is the SMILES notation for copper;propanoic acid;hydrate?
The canonical SMILES for copper;propanoic acid;hydrate is CCC(=O)O.O.[Cu].
What is the InChIKey of copper;propanoic acid;hydrate?
The InChIKey is JWSFDEVAAIOBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.Cu.H2O/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);;1H2.
What are the key properties of copper;propanoic acid;hydrate?
copper;propanoic acid;hydrate has a molecular weight of 155.64 g/mol, XLogP of -0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper;propanoic acid;hydrate is sourced from PubChem (CID 87996764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).